Difference between revisions of "CPD-12115"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)) |
+ | * inchi key: | ||
+ | ** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** demethylmenaquinol-8 |
+ | * molecular weight: | ||
+ | ** 705.118 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-demethylmenaquinol-8 |
+ | ** DMKH2-8 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873] |
− | {{#set: common name= | + | * BIGG : 1438263 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}} |
− | {{#set: | + | {{#set: common name=demethylmenaquinol-8}} |
+ | {{#set: molecular weight=705.118 }} | ||
+ | {{#set: common name=2-demethylmenaquinol-8|DMKH2-8}} | ||
+ | {{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}} |
Latest revision as of 19:15, 21 March 2018
Contents
Metabolite CPD-12115
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
- inchi key:
- InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
- common name:
- demethylmenaquinol-8
- molecular weight:
- 705.118
- Synonym(s):
- 2-demethylmenaquinol-8
- DMKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links