Difference between revisions of "XYLCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TA...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** xylose degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** xylose catabolism | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
| − | * [[ | + | * [[XYLULOKIN-RXN]] |
| − | + | ** 1 associated gene(s): | |
| − | * [[ | + | *** [[Ec-01_002810]] |
| − | * [[ | + | ** 2 reconstruction source(s) associated: |
| − | == Reaction(s) | + | *** [[annotation-esiliculosus_genome]] |
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=XYLISOM-RXN XYLISOM-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY] |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=xylose degradation I}} | |
| − | + | {{#set: common name=xylose catabolism}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:15, 21 March 2018
Pathway XYLCAT-PWY
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- XYLULOKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
