Difference between revisions of "TRP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13162 RXN-13162] == * direction: ** LEFT-TO-RIGHT * common name: ** Isopentenyl-diphosphate del...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == |
− | * | + | * smiles: |
− | ** | + | ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) |
+ | * inchi key: | ||
+ | ** InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-tryptophan |
− | * | + | * molecular weight: |
− | ** | + | ** 204.228 |
* Synonym(s): | * Synonym(s): | ||
+ | ** trp | ||
+ | ** W | ||
+ | ** tryptacin | ||
+ | ** trofan | ||
+ | ** tryptophan | ||
+ | ** 2-amino-3-indolylpropanic acid | ||
+ | ** L-trp | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] |
− | + | * [[biomass_rxn]] | |
− | * | + | * [[RXN-8665]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[TRYPSYN-RXN]] | |
− | == | + | * [[RXN0-2382]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 73-22-3 |
− | ** [http:// | + | * BIGG : 33772 |
− | ** [http://www. | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923516 6923516] |
− | ** [http://www. | + | * HMDB : HMDB00929 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00078 C00078] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57912 57912] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57912 |
− | {{#set: | + | {{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}} |
− | + | {{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N}} | |
− | {{#set: | + | {{#set: common name=L-tryptophan}} |
+ | {{#set: molecular weight=204.228 }} | ||
+ | {{#set: common name=trp|W|tryptacin|trofan|tryptophan|2-amino-3-indolylpropanic acid|L-trp}} | ||
+ | {{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN|biomass_rxn|RXN-8665}} | ||
+ | {{#set: produced by=TRYPSYN-RXN|RXN0-2382}} |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite TRP
- smiles:
- C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
- inchi key:
- InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N
- common name:
- L-tryptophan
- molecular weight:
- 204.228
- Synonym(s):
- trp
- W
- tryptacin
- trofan
- tryptophan
- 2-amino-3-indolylpropanic acid
- L-trp
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-22-3
- BIGG : 33772
- PUBCHEM:
- HMDB : HMDB00929
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57912
"C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))" cannot be used as a page name in this wiki.