Difference between revisions of "ADENOSYLHOMOCYSTEINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSTEINASE-RXN ADENOSYLHOMOCYSTEINASE-RXN] == * direction: ** REVERSIBLE * ec number: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSTEINASE-RXN ADENOSYLHOMOCYSTEINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.3.1.1 EC-3.3.1.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[ADENOSINE]][c] '''+''' 1 [[HOMO-CYS]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H2O[c] '''<=>''' 1 adenosine[c] '''+''' 1 L-homocysteine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-22_002610]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[METHIONINE-DEG1-PWY]], L-methionine degradation I (to L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-DEG1-PWY METHIONINE-DEG1-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21708 21708] |
− | ** [http:// | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00192 R00192] |
− | ** [http://www. | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P10760 P10760] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P10819 P10819] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P23526 P23526] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28183 P28183] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50250 P50250] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P60176 P60176] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58783 Q58783] |
+ | ** [http://www.uniprot.org/uniprot/O23255 O23255] | ||
+ | ** [http://www.uniprot.org/uniprot/O27673 O27673] | ||
+ | ** [http://www.uniprot.org/uniprot/O29376 O29376] | ||
+ | ** [http://www.uniprot.org/uniprot/O28279 O28279] | ||
+ | ** [http://www.uniprot.org/uniprot/P51893 P51893] | ||
+ | ** [http://www.uniprot.org/uniprot/P50245 P50245] | ||
+ | ** [http://www.uniprot.org/uniprot/P26799 P26799] | ||
+ | ** [http://www.uniprot.org/uniprot/P35007 P35007] | ||
+ | ** [http://www.uniprot.org/uniprot/P39954 P39954] | ||
+ | ** [http://www.uniprot.org/uniprot/P50252 P50252] | ||
+ | ** [http://www.uniprot.org/uniprot/P50249 P50249] | ||
+ | ** [http://www.uniprot.org/uniprot/P74008 P74008] | ||
+ | ** [http://www.uniprot.org/uniprot/P32112 P32112] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9UG84 Q9UG84] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01781 Q01781] | ||
+ | ** [http://www.uniprot.org/uniprot/P27604 P27604] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-3.3.1.1}} | ||
+ | {{#set: gene associated=Ec-22_002610}} | ||
+ | {{#set: in pathway=METHIONINE-DEG1-PWY|PWY-5041}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:15, 21 March 2018
Contents
Reaction ADENOSYLHOMOCYSTEINASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ADENOSYL-HOMO-CYS[c] + 1 WATER[c] <=> 1 ADENOSINE[c] + 1 HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-homocysteine[c] + 1 H2O[c] <=> 1 adenosine[c] + 1 L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-22_002610
- Source: orthology-aragem
Pathways
- METHIONINE-DEG1-PWY, L-methionine degradation I (to L-homocysteine): METHIONINE-DEG1-PWY
- 2 reactions found over 3 reactions in the full pathway
- PWY-5041, S-adenosyl-L-methionine cycle II: PWY-5041
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: