Difference between revisions of "N-4-aminobutylidene-eIF5A-lysine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-eIF5A-lysine N-4-aminobutylidene-eIF5A-lysine] == * common name: ** an [eIF...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-eIF5A-lysine N-4-aminobutylidene-eIF5A-lysine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** an N-(4-aminobutylidene)-[eIF5A-precursor]-lysine |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13417]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13416]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine}} | |
− | + | {{#set: common name=an N-(4-aminobutylidene)-[eIF5A-precursor]-lysine}} | |
− | + | {{#set: consumed by=RXN-13417}} | |
− | + | {{#set: produced by=RXN-13416}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:15, 21 March 2018
Contents
Metabolite N-4-aminobutylidene-eIF5A-lysine
- common name:
- an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine
- Synonym(s):
- an N-(4-aminobutylidene)-[eIF5A-precursor]-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine" cannot be used as a page name in this wiki.
"an N-(4-aminobutylidene)-[eIF5A-precursor]-lysine" cannot be used as a page name in this wiki.