Difference between revisions of "DOPAQUINONE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_002420 == * Synonym(s): ** Esi_0337_0027 ** Esi0337_0027 == Reactions associated == * Reaction: DIAMINOPIMDECARB-RXN ** Source: ortholog...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == |
+ | * smiles: | ||
+ | ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N | ||
+ | * common name: | ||
+ | ** dopaquinone | ||
+ | * molecular weight: | ||
+ | ** 195.174 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-11369]] |
− | * | + | * [[RXN-8483]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-13061]] |
− | * [[ | + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00822 C00822] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57924 57924] | ||
+ | * METABOLIGHTS : MTBLC57924 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229226 44229226] | ||
+ | * HMDB : HMDB01229 | ||
+ | {{#set: smiles=C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)}} | ||
+ | {{#set: inchi key=InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N}} | ||
+ | {{#set: common name=dopaquinone}} | ||
+ | {{#set: molecular weight=195.174 }} | ||
+ | {{#set: consumed by=RXN-11369|RXN-8483}} | ||
+ | {{#set: produced by=RXN-13061|MONOPHENOL-MONOOXYGENASE-RXN}} |
Latest revision as of 19:15, 21 March 2018
Contents
Metabolite DOPAQUINONE
- smiles:
- C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)
- inchi key:
- InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N
- common name:
- dopaquinone
- molecular weight:
- 195.174
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)" cannot be used as a page name in this wiki.