Difference between revisions of "Ec-02 001860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Ec-02_001860 == * Synonym(s): ** Esi_0055_0135 ** Esi0055_0135 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Gene Ec-02_001860 ==
* smiles:
+
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
* inchi key:
+
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
+
* common name:
+
** 1D-myo-inositol 6-monophosphate
+
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
** Ins(6)P1
+
** Esi_0055_0135
** 1D-myo-inositol 6-phosphate
+
** Esi0055_0135
** Ins(6)P
+
** Ins6P
+
** D-myo-inositol 6-monophosphate
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10954]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0055_0135|Esi0055_0135}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
+
{{#set: reaction associated=RXN-8443}}
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
+
{{#set: common name=1D-myo-inositol 6-monophosphate}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
+
{{#set: consumed by=RXN-10954}}
+

Latest revision as of 19:16, 21 March 2018

Gene Ec-02_001860

  • Synonym(s):
    • Esi_0055_0135
    • Esi0055_0135

Reactions associated

Pathways associated

External links