Difference between revisions of "Ec-02 001860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-02_001860 == * Synonym(s): ** Esi_0055_0135 ** Esi0055_0135 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_001860 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0055_0135 |
− | ** | + | ** Esi0055_0135 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-8443]] |
− | + | ** Source: [[orthology-aragem]] | |
− | == | + | == Pathways associated == |
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0055_0135|Esi0055_0135}} | |
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:16, 21 March 2018
Gene Ec-02_001860
- Synonym(s):
- Esi_0055_0135
- Esi0055_0135
Reactions associated
- Reaction: RXN-8443
- Source: orthology-aragem