Difference between revisions of "GALDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GALDEG-PWY GALDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TA...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GALDEG-PWY GALDEG-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-galactose degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** De Ley-Doudoroff pathway |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[GALACTONOLACTONASE-RXN]] |
| − | * [[ | + | ** 2 associated gene(s): |
| − | * [[ | + | *** [[Ec-10_002500]] |
| − | * [[ | + | *** [[Ec-21_001990]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| − | + | *** [[annotation-esiliculosus_genome]] | |
| − | * [ | + | == Reaction(s) not found == |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GALACTODEHYDROG-RXN GALACTODEHYDROG-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=D-galactose degradation II}} | |
| − | + | {{#set: common name=De Ley-Doudoroff pathway}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:16, 21 March 2018
Pathway GALDEG-PWY
- taxonomic range:
- common name:
- D-galactose degradation II
- Synonym(s):
- De Ley-Doudoroff pathway
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- GALACTONOLACTONASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
