Difference between revisions of "Ec-01 008240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-01_008240 == * left end position: ** 7044345 * transcription direction: ** POSITIVE * right end position: ** 7052742 * centisome position: ** 68.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Gene Ec-01_008240 ==
−
* smiles:
+
* left end position:
−
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
** 7044345
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 1D-myo-inositol 6-monophosphate
+
** 7052742
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 68.26687    
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(6)P1
+
** Esi_0002_0034
−
** 1D-myo-inositol 6-phosphate
+
** Esi0002_0034
−
** Ins(6)P
+
** FTSZ
−
** Ins6P
+
−
** D-myo-inositol 6-monophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10954]]
+
* Reaction: [[RXN0-5462]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7044345}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=7052742}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
+
{{#set: centisome position=68.26687   }}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: common name=Esi_0002_0034|Esi0002_0034|FTSZ}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
+
{{#set: reaction associated=RXN0-5462}}
−
{{#set: common name=1D-myo-inositol 6-monophosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
+
−
{{#set: consumed by=RXN-10954}}
+

Latest revision as of 19:16, 21 March 2018

Gene Ec-01_008240

  • left end position:
    • 7044345
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7052742
  • centisome position:
    • 68.26687
  • Synonym(s):
    • Esi_0002_0034
    • Esi0002_0034
    • FTSZ

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_008240&oldid=25725"