Difference between revisions of "RXN-15510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15510 RXN-15510] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15510 RXN-15510] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | + | ||
| − | + | ||
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[2-PG]][c] '''+''' 1 [[Protein-pi-phospho-L-histidines]][c] '''<=>''' 1 [[Protein-Histidines]][c] '''+''' 1 [[23-DIPHOSPHOGLYCERATE]][c] | |
| − | = | + | * With common name(s): |
| − | * [[ | + | ** 1 2-phospho-D-glycerate[c] '''+''' 1 a [protein]-Nπ-phospho-L-histidine[c] '''<=>''' 1 a [protein]-L-histidine[c] '''+''' 1 2,3-diphospho-D-glycerate[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | == Pathways == |
| − | + | == Reconstruction information == | |
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:16, 21 March 2018
Contents
Reaction RXN-15510
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-PG[c] + 1 Protein-pi-phospho-L-histidines[c] <=> 1 Protein-Histidines[c] + 1 23-DIPHOSPHOGLYCERATE[c]
- With common name(s):
- 1 2-phospho-D-glycerate[c] + 1 a [protein]-Nπ-phospho-L-histidine[c] <=> 1 a [protein]-L-histidine[c] + 1 2,3-diphospho-D-glycerate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
