Difference between revisions of "Ec-13 001240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
 
(Created page with "Category:Gene == Gene Ec-13_001240 == * left end position: ** 2230135 * transcription direction: ** NEGATIVE * right end position: ** 2232354 * centisome position: ** 32.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Gene Ec-13_001240 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 2230135
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** tetrahydrogeranylgeranyl chlorophyll a
+
** 2232354
−
* molecular weight:
+
* centisome position:
−
** 890.479    
+
** 32.151802    
 
* Synonym(s):
 
* Synonym(s):
−
** tetrahydroGG-chlorophyll a
+
** Esi_0410_0001
−
** tetrahydroGG-chl a
+
** Esi0410_0001
−
** tetrahydrogeranylgeranyl-chl a
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7666]]
+
* Reaction: [[2.7.1.68-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7665]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2230135}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: right end position=2232354}}
−
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: centisome position=32.151802   }}
−
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: common name=Esi_0410_0001|Esi0410_0001}}
−
{{#set: molecular weight=890.479   }}
+
{{#set: reaction associated=2.7.1.68-RXN}}
−
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
{{#set: consumed by=RXN-7666}}
+
−
{{#set: produced by=RXN-7665}}
+

Latest revision as of 19:16, 21 March 2018

Gene Ec-13_001240

  • left end position:
    • 2230135
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2232354
  • centisome position:
    • 32.151802
  • Synonym(s):
    • Esi_0410_0001
    • Esi0410_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_001240&oldid=25745"