Difference between revisions of "PWY-6320"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
−
* inchi key:
+
−
** InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J
+
 
* common name:
 
* common name:
−
** phenylacetyl-CoA
+
** phaselate biosynthesis
−
* molecular weight:
+
−
** 881.637   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phenylacetate-CoA
+
** o-diphenol biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10821]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-10_001480]]
 +
*** [[Ec-04_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.133-RXN 2.3.1.133-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10825 RXN-10825]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2581 RXN-2581]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2621 RXN-2621]
 
== External links  ==
 
== External links  ==
−
* BIGG : 35419
+
{{#set: taxonomic range=TAX-3803}}
−
* PUBCHEM:
+
{{#set: common name=phaselate biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266611 45266611]
+
{{#set: common name=o-diphenol biosynthesis}}
−
* HMDB : HMDB06503
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: total reaction=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00582 C00582]
+
{{#set: completion rate=20.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57390 57390]
+
−
* METABOLIGHTS : MTBLC57390
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J}}
+
−
{{#set: common name=phenylacetyl-CoA}}
+
−
{{#set: molecular weight=881.637    }}
+
−
{{#set: common name=phenylacetate-CoA}}
+
−
{{#set: consumed by=RXN-10821}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY-6320

  • taxonomic range:
  • common name:
    • phaselate biosynthesis
  • Synonym(s):
    • o-diphenol biosynthesis

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6320&oldid=25774"