Difference between revisions of "BETSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TA...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** glycine betaine biosynthesis I (Gram-negative bacteria) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''2''' reactions in the full pathway |
| − | * [[ | + | * [[BADH-RXN]] |
| − | + | ** 1 associated gene(s): | |
| − | * [[RXN- | + | *** [[Ec-20_003790]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[orthology-aragem]] | ||
| + | * [[CHD-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-00_005920]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-1224}} |
| − | + | {{#set: common name=glycine betaine biosynthesis I (Gram-negative bacteria)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:17, 21 March 2018
Pathway BETSYN-PWY
- taxonomic range:
- common name:
- glycine betaine biosynthesis I (Gram-negative bacteria)
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- BADH-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- CHD-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
