Difference between revisions of "Ec-07 001680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Gene == Gene Ec-07_001680 == * left end position: ** 1841914 * transcription direction: ** NEGATIVE * right end position: ** 1849362 * centisome position: ** 23.8...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_001680 == |
− | * | + | * left end position: |
− | ** | + | ** 1841914 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1849362 |
− | * | + | * centisome position: |
− | ** | + | ** 23.851482 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0362_0014 |
− | ** | + | ** Esi0362_0014 |
− | ** | + | ** CYP5162A1 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1841914}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1849362}} | |
− | + | {{#set: centisome position=23.851482 }} | |
− | + | {{#set: common name=Esi_0362_0014|Esi0362_0014|CYP5162A1}} | |
− | + | {{#set: reaction associated=UNSPECIFIC-MONOOXYGENASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:17, 21 March 2018
Gene Ec-07_001680
- left end position:
- 1841914
- transcription direction:
- NEGATIVE
- right end position:
- 1849362
- centisome position:
- 23.851482
- Synonym(s):
- Esi_0362_0014
- Esi0362_0014
- CYP5162A1
Reactions associated
- Reaction: UNSPECIFIC-MONOOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome