Difference between revisions of "RXN-16426"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16426 RXN-16426] == * direction: ** REVERSIBLE * common name: ** Phosphoacetylglucosamine mutas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16426 RXN-16426] ==
* smiles:
+
* direction:
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
+
 
* common name:
 
* common name:
** ε-carotene
+
** Phosphoacetylglucosamine mutase
* molecular weight:
+
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
** ε,ε-carotene
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-8028]]
+
** 1 [[Phosphoacetylglucosamine-Mutase]][c] '''+''' 1 [[N-ACETYL-D-GLUCOSAMINE-16-BIS-P]][c] '''<=>''' 1 [[N-ACETYL-D-GLUCOSAMINE-1-P]][c] '''+''' 1 [[Phosphoacetylglucosamine-Mutase-P]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a phosphoacetylglucosamine mutase[c] '''+''' 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c] '''<=>''' 1 N-acetyl-&alpha;-D-glucosamine 1-phosphate[c] '''+''' 1 a phosphorylated phosphoacetylglucosamine mutase[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_005030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
+
{{#set: common name=Phosphoacetylglucosamine mutase}}
* LIGAND-CPD:
+
{{#set: gene associated=Ec-10_005030}}
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
+
{{#set: in pathway=}}
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=&epsilon;-carotene}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=536.882    }}
+
{{#set: common name=&epsilon;,&epsilon;-carotene}}
+
{{#set: produced by=RXN-8028}}
+

Latest revision as of 19:17, 21 March 2018

Reaction RXN-16426

  • direction:
    • REVERSIBLE
  • common name:
    • Phosphoacetylglucosamine mutase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links