Difference between revisions of "CDP-CHOLINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-23_003460 == * left end position: ** 3706742 * transcription direction: ** POSITIVE * right end position: ** 3715455 * centisome position: ** 76.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-23_003460 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
* left end position:
+
* smiles:
** 3706742
+
** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
* right end position:
+
* common name:
** 3715455
+
** CDP-choline
* centisome position:
+
* molecular weight:
** 76.59401    
+
** 487.319    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0128_0027
+
** citicoline
** Esi0128_0027
+
** citicholine
** FUMH
+
** cidifos
 +
** cyticholine
 +
** cytidine 5'-diphosphocholine
 +
** cytidine diphosphate choline
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[FUMHYDR-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[2.7.7.15-RXN]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[aragem]]
+
* [[RXN-5781]]
== Pathways associated ==
+
* [[FERMENTATION-PWY]]
+
* [[PWY-561]]
+
* [[PWY-5913]]
+
* [[P42-PWY]]
+
* [[PWY-7384]]
+
* [[PWY-5392]]
+
* [[P23-PWY]]
+
* [[P105-PWY]]
+
* [[PWY-6969]]
+
* [[PWY-6728]]
+
* [[REDCITCYC]]
+
* [[PWY-7254]]
+
* [[P108-PWY]]
+
* [[TCA]]
+
* [[PWY66-398]]
+
* [[PWY-5690]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3706742}}
+
* CAS : 987-78-0
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=3715455}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509]
{{#set: centisome position=76.59401   }}
+
* CHEBI:
{{#set: common name=Esi_0128_0027|Esi0128_0027|FUMH}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779]
{{#set: reaction associated=FUMHYDR-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=FERMENTATION-PWY|PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|TCA|PWY66-398|PWY-5690}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307]
 +
* HMDB : HMDB01413
 +
{{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}}
 +
{{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}}
 +
{{#set: common name=CDP-choline}}
 +
{{#set: molecular weight=487.319   }}
 +
{{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}}
 +
{{#set: produced by=2.7.7.15-RXN}}
 +
{{#set: reversible reaction associated=RXN-5781}}

Latest revision as of 20:17, 21 March 2018

Metabolite CDP-CHOLINE

  • smiles:
    • C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
  • inchi key:
    • InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
  • common name:
    • CDP-choline
  • molecular weight:
    • 487.319
  • Synonym(s):
    • citicoline
    • citicholine
    • cidifos
    • cyticholine
    • cytidine 5'-diphosphocholine
    • cytidine diphosphate choline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))" cannot be used as a page name in this wiki.