Difference between revisions of "CPD-4577"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE6PSYN-RXN TREHALOSE6PSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Trehalose...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol |
− | + | * molecular weight: | |
− | * | + | ** 441.673 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol | ||
+ | ** 4β-methylzymosterol-4α-carboxylate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-313]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657655 90657655] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808] |
− | * | + | * HMDB : HMDB06927 |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}} | |
− | {{#set: | + | {{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}} |
− | {{#set: | + | {{#set: molecular weight=441.673 }} |
− | {{#set: common name=alpha | + | {{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}} |
− | {{#set: | + | {{#set: consumed by=RXN66-313}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CPD-4577
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
- common name:
- 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
- molecular weight:
- 441.673
- Synonym(s):
- 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
- 4β-methylzymosterol-4α-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.