Difference between revisions of "CPD-4577"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-16_002540 == * left end position: ** 2747359 * transcription direction: ** POSITIVE * right end position: ** 2755373 * centisome position: ** 51.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-16_002540 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] ==
−
* left end position:
+
* smiles:
−
** 2747359
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
−
* right end position:
+
* common name:
−
** 2755373
+
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
−
* centisome position:
+
* molecular weight:
−
** 51.471283    
+
** 441.673    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0283_0022
+
** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
−
** Esi0283_0022
+
** 4β-methylzymosterol-4α-carboxylate
−
** MetRS
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[METHIONINE--TRNA-LIGASE-RXN]]
+
* [[RXN66-313]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-16165]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2747359}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657655 90657655]
−
{{#set: right end position=2755373}}
+
* CHEBI:
−
{{#set: centisome position=51.471283   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925]
−
{{#set: common name=Esi_0283_0022|Esi0283_0022|MetRS}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=METHIONINE--TRNA-LIGASE-RXN|RXN-16165}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808]
−
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
* HMDB : HMDB06927
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}}
 +
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: molecular weight=441.673   }}
 +
{{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}}
 +
{{#set: consumed by=RXN66-313}}

Latest revision as of 19:17, 21 March 2018

Metabolite CPD-4577

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 441.673
  • Synonym(s):
    • 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
    • 4β-methylzymosterol-4α-carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-4577&oldid=25833"