Difference between revisions of "Ec-04 005090"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...")
 
(Created page with "Category:Gene == Gene Ec-04_005090 == * left end position: ** 5131647 * transcription direction: ** NEGATIVE * right end position: ** 5139576 * centisome position: ** 78.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] ==
+
== Gene Ec-04_005090 ==
−
* smiles:
+
* left end position:
−
** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
+
** 5131647
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** adenosyl-cobyrinate a,c-diamide
+
** 5139576
−
* molecular weight:
+
* centisome position:
−
** 1182.137    
+
** 78.80474    
 
* Synonym(s):
 
* Synonym(s):
−
** adenosyl-cobyrinic acid a,c-diamide
+
** Esi_0037_0085
−
** Adenosyl cobyrinate diamide
+
** Esi0037_0085
−
** Adenosylcob(III)yrinic acid a,c-diamide
+
−
** Adenosylcobyrinic acid a,c-diamide
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-5398]]
−
* [[R344-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6019]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5131647}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5139576}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503]
+
{{#set: centisome position=78.80474   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0037_0085|Esi0037_0085}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506]
+
{{#set: reaction associated=RXN0-5398}}
−
* HMDB : HMDB01083
+
{{#set: pathway associated=PWY-6019}}
−
{{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}}
+
−
{{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}}
+
−
{{#set: common name=adenosyl-cobyrinate a,c-diamide}}
+
−
{{#set: molecular weight=1182.137   }}
+
−
{{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}}
+
−
{{#set: produced by=R344-RXN}}
+

Latest revision as of 19:17, 21 March 2018

Gene Ec-04_005090

  • left end position:
    • 5131647
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5139576
  • centisome position:
    • 78.80474
  • Synonym(s):
    • Esi_0037_0085
    • Esi0037_0085

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_005090&oldid=25841"