Difference between revisions of "CPD-706"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 24-methylenecholesterol |
| + | * molecular weight: | ||
| + | ** 398.671 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-707]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781] |
| − | {{#set: | + | * HMDB : HMDB06849 |
| − | {{#set: | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}} |
| + | {{#set: common name=24-methylenecholesterol}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: produced by=RXN-707}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CPD-706
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
- common name:
- 24-methylenecholesterol
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
