Difference between revisions of "Ec-12 005110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-12_005110 == * left end position: ** 4703486 * transcription direction: ** NEGATIVE * right end position: ** 4709236 * centisome position: ** 56.4...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_005110 == |
− | * | + | * left end position: |
− | ** | + | ** 4703486 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4709236 |
− | * | + | * centisome position: |
− | ** | + | ** 56.423424 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0287_0030 |
− | ** | + | ** Esi0287_0030 |
− | ** | + | ** adenylate kinase |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENYL-KIN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | * | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | == Pathways associated == |
− | == | + | * [[PWY-7219]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4703486}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4709236}} | |
− | + | {{#set: centisome position=56.423424 }} | |
− | + | {{#set: common name=Esi_0287_0030|Esi0287_0030|adenylate kinase}} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Gene Ec-12_005110
- left end position:
- 4703486
- transcription direction:
- NEGATIVE
- right end position:
- 4709236
- centisome position:
- 56.423424
- Synonym(s):
- Esi_0287_0030
- Esi0287_0030
- adenylate kinase
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome