Difference between revisions of "RXN0-2023"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA-specific 2-thiouridyla...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] ==
−
* smiles:
+
* direction:
−
** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I
+
 
* common name:
 
* common name:
−
** 1-(5-phospho-β-D-ribosyl)-ATP
+
** tRNA-specific 2-thiouridylase
−
* molecular weight:
+
* ec number:
−
** 714.24   
+
** [http://enzyme.expasy.org/EC/2.8.1.13 EC-2.8.1.13]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-(5-phosphoribosyl)-ATP
 
−
** N1-(5-phospho-D-ribosyl)-ATP
 
−
** 5-phosphoribosyl-ATP
 
−
** 1-(5-phospho-D-ribosyl)-ATP
 
−
** phosphoribosyl-ATP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[HISTPRATPHYD-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Donor-H2]][c] '''+''' 1 [[TusE-S-sulfanylcysteine]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[tRNA-uridine34]][c] '''=>''' 1 [[tRNA-2-thiouridine34]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[TusE-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
** 1 an reduced unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] '''+''' 1 ATP[c] '''+''' 1 a uridine34 in tRNA[c] '''=>''' 1 a 2-thiouridine34 in tRNA[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-28_002930]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01661
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=tRNA-specific 2-thiouridylase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658853 90658853]
+
{{#set: ec number=EC-2.8.1.13}}
−
* HMDB : HMDB03665
+
{{#set: gene associated=Ec-28_002930}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02739 C02739]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73200 73200]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 40470
+
−
{{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I}}
+
−
{{#set: common name=1-(5-phospho-β-D-ribosyl)-ATP}}
+
−
{{#set: molecular weight=714.24    }}
+
−
{{#set: common name=1-(5-phosphoribosyl)-ATP|N1-(5-phospho-D-ribosyl)-ATP|5-phosphoribosyl-ATP|1-(5-phospho-D-ribosyl)-ATP|phosphoribosyl-ATP}}
+
−
{{#set: consumed by=HISTPRATPHYD-RXN}}
+
−
{{#set: reversible reaction associated=ATPPHOSPHORIBOSYLTRANS-RXN}}
+

Latest revision as of 20:17, 21 March 2018

Reaction RXN0-2023

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • tRNA-specific 2-thiouridylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an reduced unknown electron acceptor[c] + 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] + 1 ATP[c] + 1 a uridine34 in tRNA[c] => 1 a 2-thiouridine34 in tRNA[c] + 1 an oxidized unknown electron acceptor[c] + 1 a [TusE sulfur carrier protein]-L-cysteine[c] + 1 H+[c] + 1 AMP[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-2023&oldid=25882"