Difference between revisions of "PWY-7227"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * smiles: ** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7227 PWY-7227] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7227 PWY-7227] ==
* smiles:
+
* taxonomic range:
** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
** InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** maltotetraose
+
** adenosine deoxyribonucleotides de novo biosynthesis
* molecular weight:
+
** 666.583   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN-14281]]
+
* [[ADPREDUCT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 7 associated gene(s):
 +
*** [[Ec-21_002920]]
 +
*** [[Ec-11_002180]]
 +
*** [[Ec-06_005570]]
 +
*** [[Ec-17_003700]]
 +
*** [[Ec-19_000440]]
 +
*** [[Ec-11_002170]]
 +
*** [[Ec-06_005120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DADPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-04_001140]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 34612-38-9
+
{{#set: taxonomic range=TAX-2759}}
* BIGG : 38985
+
{{#set: taxonomic range=TAX-2157}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439639 439639]
+
{{#set: common name=adenosine deoxyribonucleotides de novo biosynthesis}}
* HMDB : HMDB01296
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C02052 C02052]
+
{{#set: completion rate=100.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.393830.html 393830]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28460 28460]
+
* METABOLIGHTS : MTBLC61988
+
{{#set: smiles=C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O}}
+
{{#set: inchi key=InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N}}
+
{{#set: common name=maltotetraose}}
+
{{#set: molecular weight=666.583    }}
+
{{#set: produced by=RXN-14281}}
+

Latest revision as of 19:18, 21 March 2018

Pathway PWY-7227

  • taxonomic range:
  • common name:
    • adenosine deoxyribonucleotides de novo biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links