Difference between revisions of "RXN66-550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-550 RXN66-550] == * direction: ** LEFT-TO-RIGHT * common name: ** Electron transfer flavoprot...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-550 RXN66-550] ==
* smiles:
+
* direction:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
+
 
* common name:
 
* common name:
** 6-deoxocathasterone
+
** Electron transfer flavoprotein-ubiquinone oxidoreductase
* molecular weight:
+
* ec number:
** 418.702   
+
** [http://enzyme.expasy.org/EC/1.5.5.1 EC-1.5.5.1]
 
* Synonym(s):
 
* Synonym(s):
** deoxocathasterone
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-773]]
+
** 1 [[ETF-Reduced]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_002110]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01030124
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=Electron transfer flavoprotein-ubiquinone oxidoreductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202530 25202530]
+
{{#set: ec number=EC-1.5.5.1}}
* CHEBI:
+
{{#set: gene associated=Ec-23_002110}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
+
{{#set: common name=6-deoxocathasterone}}
+
{{#set: molecular weight=418.702    }}
+
{{#set: common name=deoxocathasterone}}
+
{{#set: produced by=RXN-773}}
+

Latest revision as of 20:18, 21 March 2018

Reaction RXN66-550

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Electron transfer flavoprotein-ubiquinone oxidoreductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a reduced electron-transfer flavoprotein[c] + 1 a ubiquinone[c] => 1 an ubiquinol[c] + 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links