Difference between revisions of "CPD-8259"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_010600 == * Synonym(s): ** Esi_0136_0023 ** Esi0136_0023 == Reactions associated == * RXN1K-87 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N | ||
+ | * common name: | ||
+ | ** β-D-ribosylnicotinate | ||
+ | * molecular weight: | ||
+ | ** 255.227 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nicotinic acid riboside |
− | ** | + | ** ribosylnicotinate |
+ | ** nicotinic acid ribose | ||
+ | ** nicotinate riboside | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8443]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-14227]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05841 C05841] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58527 58527] | ||
+ | * METABOLIGHTS : MTBLC58527 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161233 161233] | ||
+ | * HMDB : HMDB06809 | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}} | ||
+ | {{#set: inchi key=InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N}} | ||
+ | {{#set: common name=β-D-ribosylnicotinate}} | ||
+ | {{#set: molecular weight=255.227 }} | ||
+ | {{#set: common name=nicotinic acid riboside|ribosylnicotinate|nicotinic acid ribose|nicotinate riboside}} | ||
+ | {{#set: consumed by=RXN-8443}} | ||
+ | {{#set: produced by=RXN-14227}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-8259
- smiles:
- C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
- inchi key:
- InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N
- common name:
- β-D-ribosylnicotinate
- molecular weight:
- 255.227
- Synonym(s):
- nicotinic acid riboside
- ribosylnicotinate
- nicotinic acid ribose
- nicotinate riboside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))" cannot be used as a page name in this wiki.