Difference between revisions of "CPD-17283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17283 CPD-17283] == * common name: ** a [glycerolipid]-di-homo-γ-linolenate * Synonym...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17283 CPD-17283] ==
* smiles:
+
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholest-7-en-3-one
+
** a [glycerolipid]-di-homo-γ-linolenate
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [glycerolipid]-(8Z,11Z,14Z)-icosa-8,11,14-trienoate
 +
** a [glycerolipid]-(8Z,11Z,14Z)-icosatrienoate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[1.1.1.170-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [glycerolipid]-di-homo-γ-linolenate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345]
+
{{#set: common name=a [glycerolipid]-(8Z,11Z,14Z)-icosa-8,11,14-trienoate|a [glycerolipid]-(8Z,11Z,14Z)-icosatrienoate}}
* CHEMSPIDER:
+
{{#set: produced by=RXN-16044}}
** [http://www.chemspider.com/Chemical-Structure.389311.html 389311]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453]
+
* HMDB : HMDB11606
+
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}}
+
{{#set: common name=4α-methyl-5α-cholest-7-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: reversible reaction associated=1.1.1.170-RXN}}
+

Latest revision as of 19:18, 21 March 2018

Metabolite CPD-17283

  • common name:
    • a [glycerolipid]-di-homo-γ-linolenate
  • Synonym(s):
    • a [glycerolipid]-(8Z,11Z,14Z)-icosa-8,11,14-trienoate
    • a [glycerolipid]-(8Z,11Z,14Z)-icosatrienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-di-homo-γ-linolenate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(8Z,11Z,14Z)-icosa-8,11,14-trienoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(8Z,11Z,14Z)-icosatrienoate" cannot be used as a page name in this wiki.