Difference between revisions of "Ec-00 004510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-00_004510 == * left end position: ** 6167481 * transcription direction: ** NEGATIVE * right end position: ** 6169420 * centisome position: ** 32.5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_004510 == |
− | * | + | * left end position: |
− | ** | + | ** 6167481 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6169420 |
− | * | + | * centisome position: |
− | ** | + | ** 32.552204 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0360_0006 |
+ | ** Esi0360_0006 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.4.1.151-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | == | + | * [[PWY-7434]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=6167481}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6169420}} | |
− | + | {{#set: centisome position=32.552204 }} | |
− | + | {{#set: common name=Esi_0360_0006|Esi0360_0006}} | |
− | + | {{#set: reaction associated=2.4.1.151-RXN}} | |
− | + | {{#set: pathway associated=PWY-7434}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Gene Ec-00_004510
- left end position:
- 6167481
- transcription direction:
- NEGATIVE
- right end position:
- 6169420
- centisome position:
- 32.552204
- Synonym(s):
- Esi_0360_0006
- Esi0360_0006
Reactions associated
- Reaction: 2.4.1.151-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome