Difference between revisions of "CGMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-23_002720 == * left end position: ** 2822394 * transcription direction: ** NEGATIVE * right end position: ** 2830933 * centisome position: ** 58.3...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-23_002720 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
−
* left end position:
+
* smiles:
−
** 2822394
+
** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
−
* right end position:
+
* common name:
−
** 2830933
+
** cyclic-GMP
−
* centisome position:
+
* molecular weight:
−
** 58.32035    
+
** 344.2    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0132_0008
+
** 3',5'-cyclic GMP
−
** Esi0132_0008
+
** guanosine-cyclic-phosphoric-acid
 +
** cGMP
 +
** guanosine cyclic-monophosphate
 +
** guanosine 3',5'-cyclic-monophosphate
 +
** guanosine 3',5'-cyclic phosphate
 +
** cyclic 3',5'-guanosine monophosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLYCPDIESTER-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
−
***go-term
+
* [[GUANYLCYC-RXN]]
−
* [[RXN-14073]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-14136]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-14160]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
−
* [[PWY-7409]]
+
−
* [[PWY-6952]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2822394}}
+
* CAS : 7665-99-8
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=2830933}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16727415 16727415]
−
{{#set: centisome position=58.32035   }}
+
* HMDB : HMDB01314
−
{{#set: common name=Esi_0132_0008|Esi0132_0008}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00942 C00942]
−
{{#set: pathway associated=PWY-7409|PWY-6952}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20559156.html 20559156]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57746 57746]
 +
* METABOLIGHTS : MTBLC57746
 +
{{#set: smiles=C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M}}
 +
{{#set: common name=cyclic-GMP}}
 +
{{#set: molecular weight=344.2   }}
 +
{{#set: common name=3',5'-cyclic GMP|guanosine-cyclic-phosphoric-acid|cGMP|guanosine cyclic-monophosphate|guanosine 3',5'-cyclic-monophosphate|guanosine 3',5'-cyclic phosphate|cyclic 3',5'-guanosine monophosphate}}
 +
{{#set: reversible reaction associated=GUANYLCYC-RXN}}

Latest revision as of 20:19, 21 March 2018

Metabolite CGMP

  • smiles:
    • C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
  • inchi key:
    • InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
  • common name:
    • cyclic-GMP
  • molecular weight:
    • 344.2
  • Synonym(s):
    • 3',5'-cyclic GMP
    • guanosine-cyclic-phosphoric-acid
    • cGMP
    • guanosine cyclic-monophosphate
    • guanosine 3',5'-cyclic-monophosphate
    • guanosine 3',5'-cyclic phosphate
    • cyclic 3',5'-guanosine monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CGMP&oldid=26039"