Difference between revisions of "Ec-27 002710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...") |
(Created page with "Category:Gene == Gene Ec-27_002710 == * left end position: ** 2389214 * transcription direction: ** POSITIVE * right end position: ** 2391497 * centisome position: ** 37.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_002710 == |
− | * | + | * left end position: |
− | ** | + | ** 2389214 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2391497 |
− | * | + | * centisome position: |
− | ** | + | ** 37.04261 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0643 |
+ | ** Esi0000_0643 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-15041]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2389214}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2391497}} | |
− | + | {{#set: centisome position=37.04261 }} | |
− | + | {{#set: common name=Esi_0000_0643|Esi0000_0643}} | |
− | + | {{#set: reaction associated=RXN-15041}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Gene Ec-27_002710
- left end position:
- 2389214
- transcription direction:
- POSITIVE
- right end position:
- 2391497
- centisome position:
- 37.04261
- Synonym(s):
- Esi_0000_0643
- Esi0000_0643
Reactions associated
- Reaction: RXN-15041
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome