Difference between revisions of "GLYSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY] ==
* smiles:
+
* taxonomic range:
** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
** InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
+
 
* common name:
 
* common name:
** OPC8-3-hydroxyacyl-CoA
+
** glycine biosynthesis I
* molecular weight:
+
** 1055.92   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10698]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLYOHMETRANS-RXN]]
* [[RXN-10697]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-14_004260]]
 +
*** [[Ec-24_002640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237307 44237307]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
* ARACYC:
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY]
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=1055.92    }}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA}}
+
{{#set: common name=glycine biosynthesis I}}
{{#set: consumed by=RXN-10698}}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN-10697}}
+
{{#set: total reaction=1}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:19, 21 March 2018

Pathway GLYSYN-PWY

  • taxonomic range:
  • common name:
    • glycine biosynthesis I
  • Synonym(s):

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links