Difference between revisions of "PWY-6113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-17...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-1762]
* inchi key:
+
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
+
 
* common name:
 
* common name:
** cholest-5-en-3-one
+
** superpathway of mycolate biosynthesis
* molecular weight:
+
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''12''' reactions in the full pathway
* [[RXN-12693]]
+
* [[PWY-4381]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[PWY-5971]]
 +
** 0 associated gene:
 +
* [[PWY-5989]]
 +
** 0 associated gene:
 +
* [[PWYG-321]]
 +
** 0 associated gene:
 +
* [[RXN-10059]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10060]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-10062]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1762}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
+
{{#set: common name=superpathway of mycolate biosynthesis}}
* CHEBI:
+
{{#set: reaction found=7}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
+
{{#set: total reaction=12}}
* METABOLIGHTS : MTBLC63906
+
{{#set: completion rate=58.0}}
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
+
{{#set: common name=cholest-5-en-3-one}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: produced by=RXN-12693}}
+

Latest revision as of 20:19, 21 March 2018

Pathway PWY-6113

  • taxonomic range:
  • common name:
    • superpathway of mycolate biosynthesis
  • Synonym(s):

Reaction(s) found

7 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links