Difference between revisions of "PROPIONMET-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PROPIONMET-PWY PROPIONMET-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PROPIONMET-PWY PROPIONMET-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* common name: | * common name: | ||
| − | ** | + | ** propanoyl CoA degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** propionyl CoA degradation I |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[PROPIONYL-COA-CARBOXY-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-01_010970]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PROPIONMET-PWY PROPIONMET-PWY] |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-33154}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=propanoyl CoA degradation I}} | |
| − | + | {{#set: common name=propionyl CoA degradation I}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | {{#set: | + | {{#set: completion rate=33.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Pathway PROPIONMET-PWY
- taxonomic range:
- common name:
- propanoyl CoA degradation I
- Synonym(s):
- propionyl CoA degradation I
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- PROPIONYL-COA-CARBOXY-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
