Difference between revisions of "MALATE-ASPARTATE-SHUTTLE-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MALATE-ASPARTATE-SHUTTLE-PWY MALATE-ASPARTATE-SHUTTLE-PWY] == * taxonomic range: ** [http://metacyc.o...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MALATE-ASPARTATE-SHUTTLE-PWY MALATE-ASPARTATE-SHUTTLE-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** L-aspartate degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** malate/L-aspartate shuttle pathway |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[ASPAMINOTRANS-RXN]] |
| − | * [[ | + | ** 3 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-03_003270]] |
| + | *** [[Ec-01_007480]] | ||
| + | *** [[Ec-23_003500]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[MALATE-DEH-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-10_006200]] | ||
| + | *** [[Ec-02_003100]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-aspartate degradation II}} | |
| − | + | {{#set: common name=malate/L-aspartate shuttle pathway}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Pathway MALATE-ASPARTATE-SHUTTLE-PWY
- taxonomic range:
- common name:
- L-aspartate degradation II
- Synonym(s):
- malate/L-aspartate shuttle pathway
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- ASPAMINOTRANS-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- MALATE-DEH-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
