Difference between revisions of "CPD-13684"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphothreonine MAP-Kinase-L-Phosphothreonine] == * common name: ** a [mitogen-ac...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphothreonine MAP-Kinase-L-Phosphothreonine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
 +
* smiles:
 +
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
 
* common name:
 
* common name:
** a [mitogen-activated protein kinase] L-threonine phosphate
+
** cholest-5-en-3-one
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.7.12.2-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a [mitogen-activated protein kinase] L-threonine phosphate}}
+
* PUBCHEM:
{{#set: reversible reaction associated=2.7.12.2-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
 +
* METABOLIGHTS : MTBLC63906
 +
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
 +
{{#set: common name=cholest-5-en-3-one}}
 +
{{#set: molecular weight=384.644    }}
 +
{{#set: produced by=RXN-12693}}

Latest revision as of 19:19, 21 March 2018

Metabolite CPD-13684

  • smiles:
    • CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
  • common name:
    • cholest-5-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.