Difference between revisions of "Ec-27 006070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
(Created page with "Category:Gene == Gene Ec-27_006070 == * left end position: ** 5651414 * transcription direction: ** POSITIVE * right end position: ** 5672532 * centisome position: ** 87.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Gene Ec-27_006070 ==
−
* smiles:
+
* left end position:
−
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5651414
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-ketovaleryl-CoA
+
** 5672532
−
* molecular weight:
+
* centisome position:
−
** 861.604    
+
** 87.62009    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0000_0077
 +
** Esi0000_0077
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12561]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5651414}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=5672532}}
−
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: centisome position=87.62009    }}
−
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: common name=Esi_0000_0077|Esi0000_0077}}
−
{{#set: molecular weight=861.604    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: reversible reaction associated=RXN-12561}}
+

Latest revision as of 19:19, 21 March 2018

Gene Ec-27_006070

  • left end position:
    • 5651414
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5672532
  • centisome position:
    • 87.62009
  • Synonym(s):
    • Esi_0000_0077
    • Esi0000_0077

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_006070&oldid=26083"