Difference between revisions of "Ec-21 004790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Gene == Gene Ec-21_004790 == * left end position: ** 5709697 * transcription direction: ** POSITIVE * right end position: ** 5719759 * centisome position: ** 77.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_004790 == |
− | * | + | * left end position: |
− | ** | + | ** 5709697 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5719759 |
− | * | + | * centisome position: |
− | ** | + | ** 77.36592 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0131_0017 |
− | ** | + | ** Esi0131_0017 |
+ | ** Amt1;9 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-9615]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5709697}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5719759}} | |
− | + | {{#set: centisome position=77.36592 }} | |
− | + | {{#set: common name=Esi_0131_0017|Esi0131_0017|Amt1;9}} | |
− | + | {{#set: reaction associated=RXN-9615}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:19, 21 March 2018
Gene Ec-21_004790
- left end position:
- 5709697
- transcription direction:
- POSITIVE
- right end position:
- 5719759
- centisome position:
- 77.36592
- Synonym(s):
- Esi_0131_0017
- Esi0131_0017
- Amt1;9
Reactions associated
- Reaction: RXN-9615
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome