Difference between revisions of "DNA-6-Methyl-Amino-Purines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-6-Methyl-Amino-Purines DNA-6-Methyl-Amino-Purines] == * Synonym(s): ** a DNA 6-methylaminop...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-6-Methyl-Amino-Purines DNA-6-Methyl-Amino-Purines] ==
* smiles:
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
+
* common name:
+
** 5-dehydroavenasterol
+
* molecular weight:
+
** 410.682   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a DNA 6-methylaminopurine
 +
** DNA 6-methylaminopurine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4210]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4209]]
+
* [[2.1.1.72-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a DNA 6-methylaminopurine|DNA 6-methylaminopurine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724575 23724575]
+
{{#set: produced by=2.1.1.72-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
+
* HMDB : HMDB06852
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
+
{{#set: common name=5-dehydroavenasterol}}
+
{{#set: molecular weight=410.682    }}
+
{{#set: consumed by=RXN-4210}}
+
{{#set: produced by=RXN-4209}}
+

Latest revision as of 20:20, 21 March 2018

Metabolite DNA-6-Methyl-Amino-Purines

  • Synonym(s):
    • a DNA 6-methylaminopurine
    • DNA 6-methylaminopurine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links