Difference between revisions of "Ec-01 003960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Gene == Gene Ec-01_003960 == * left end position: ** 3306866 * transcription direction: ** POSITIVE * right end position: ** 3310854 * centisome position: ** 32.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003960 == |
− | * | + | * left end position: |
− | ** | + | ** 3306866 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3310854 |
− | * | + | * centisome position: |
− | ** | + | ** 32.046898 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0345 |
− | ** | + | ** Esi0003_0345 |
− | ** | + | ** GPAT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-10462]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-13805]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-1381]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15045]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16024]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16117]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17016]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17017]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17018]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[TRIGLSYN-PWY]] | ||
+ | * [[PWY-5667]] | ||
+ | * [[PWY0-1319]] | ||
+ | * [[PWY-7411]] | ||
+ | * [[PWY-7587]] | ||
+ | * [[PWY-6453]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3306866}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3310854}} | |
− | + | {{#set: centisome position=32.046898 }} | |
− | + | {{#set: common name=Esi_0003_0345|Esi0003_0345|GPAT}} | |
− | + | {{#set: reaction associated=RXN-10462|RXN-13805|RXN-1381|RXN-15045|RXN-16024|RXN-16117|RXN-17016|RXN-17017|RXN-17018}} | |
− | + | {{#set: pathway associated=TRIGLSYN-PWY|PWY-5667|PWY0-1319|PWY-7411|PWY-7587|PWY-6453}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:20, 21 March 2018
Gene Ec-01_003960
- left end position:
- 3306866
- transcription direction:
- POSITIVE
- right end position:
- 3310854
- centisome position:
- 32.046898
- Synonym(s):
- Esi_0003_0345
- Esi0003_0345
- GPAT
Reactions associated
- Reaction: RXN-10462
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13805
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-1381
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15045
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16024
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16117
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17016
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17017
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17018
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome