Difference between revisions of "ALLYSINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCDEHYDRAT-RXN DTDPGLUCDEHYDRAT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** dTDP-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCDEHYDRAT-RXN DTDPGLUCDEHYDRAT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)CCCC([N+])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
 
* common name:
 
* common name:
−
** dTDP-glucose 4,6-dehydratase
+
** (S)-2-amino-6-oxohexanoate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.1.46 EC-4.2.1.46]
+
** 145.158   
 
* Synonym(s):
 
* Synonym(s):
 +
** allysine
 +
** L-2-aminoadipate 6-semialdehyde
 +
** 2-aminoadipate 6-semialdehyde
 +
** α-aminoadipate 6-semialdehyde
 +
** 2-aminoadipate semialdehyde
 +
** L-allysine
 +
** (S)-2-aminoadipate 6-semialdehyde
 +
** 2-aminoadipate-6-semialdehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.2.1.31-RXN]]
−
** 1 [[DTDP-D-GLUCOSE]][c] '''=>''' 1 [[DTDP-DEOH-DEOXY-GLUCOSE]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[1.5.1.9-RXN]]
−
** 1 dTDP-α-D-glucose[c] '''=>''' 1 dTDP-4-dehydro-6-deoxy-α-D-glucopyranose[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-8173]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_007350]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-27_005770]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-7315]], dTDP-N-acetylthomosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7315 PWY-7315]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7316]], dTDP-N-acetylviosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7316 PWY-7316]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6953]], dTDP-3-acetamido-α-D-fucos biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6953 PWY-6953]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7301]], dTDP-4-O-demethyl-β-L-noviose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7301 PWY-7301]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7657]], dTDP-β-L-digitoxose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7657 PWY-7657]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7318]], dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7318 PWY-7318]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7312]], dTDP-D-β-fucofuranose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7312 PWY-7312]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6942]], dTDP-D-desosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6942 PWY-6942]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-7104]], dTDP-L-megosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7104 PWY-7104]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-7440]], dTDP-β-L-4-epi-vancosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7440 PWY-7440]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[DTDPRHAMSYN-PWY]], dTDP-L-rhamnose biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6808]], dTDP-D-forosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6808 PWY-6808]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7413]], dTDP-6-deoxy-α-D-allose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7413 PWY-7413]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6976]], dTDP-L-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7688]], dTDP-D-ravidosamine and dTDP-4-acetyl-D-ravidosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7688 PWY-7688]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6974]], dTDP-L-olivose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6973]], dTDP-D-olivose, dTDP-D-oliose and dTDP-D-mycarose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6973 PWY-6973]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-3221]], dTDP-L-rhamnose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3221 PWY-3221]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7414]], dTDP-α-D-mycaminose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7414 PWY-7414]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 1962-83-0
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17221 17221]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688062 36688062]
−
** [http://www.genome.jp/dbget-bin/www_bget?R06513 R06513]
+
* HMDB : HMDB59595
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9R5L1 Q9R5L1]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04076 C04076]
−
** [http://www.uniprot.org/uniprot/P44914 P44914]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P29782 P29782]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58321 58321]
−
** [http://www.uniprot.org/uniprot/P27830 P27830]
+
* METABOLIGHTS : MTBLC58321
−
** [http://www.uniprot.org/uniprot/P55294 P55294]
+
{{#set: smiles=[CH](=O)CCCC([N+])C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q9S642 Q9S642]
+
{{#set: inchi key=InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N}}
−
** [http://www.uniprot.org/uniprot/P37759 P37759]
+
{{#set: common name=(S)-2-amino-6-oxohexanoate}}
−
** [http://www.uniprot.org/uniprot/P26391 P26391]
+
{{#set: molecular weight=145.158    }}
−
** [http://www.uniprot.org/uniprot/Q59626 Q59626]
+
{{#set: common name=allysine|L-2-aminoadipate 6-semialdehyde|2-aminoadipate 6-semialdehyde|α-aminoadipate 6-semialdehyde|2-aminoadipate semialdehyde|L-allysine|(S)-2-aminoadipate 6-semialdehyde|2-aminoadipate-6-semialdehyde}}
−
** [http://www.uniprot.org/uniprot/P39630 P39630]
+
{{#set: consumed by=1.2.1.31-RXN}}
−
** [http://www.uniprot.org/uniprot/P37777 P37777]
+
{{#set: produced by=1.5.1.9-RXN}}
−
** [http://www.uniprot.org/uniprot/P37761 P37761]
+
{{#set: reversible reaction associated=RXN-8173}}
−
** [http://www.uniprot.org/uniprot/Q54144 Q54144]
+
−
** [http://www.uniprot.org/uniprot/Q56173 Q56173]
+
−
** [http://www.uniprot.org/uniprot/Q55420 Q55420]
+
−
** [http://www.uniprot.org/uniprot/P55293 P55293]
+
−
** [http://www.uniprot.org/uniprot/O66249 O66249]
+
−
** [http://www.uniprot.org/uniprot/Q9RMC4 Q9RMC4]
+
−
** [http://www.uniprot.org/uniprot/O08246 O08246]
+
−
** [http://www.uniprot.org/uniprot/Q9RR28 Q9RR28]
+
−
** [http://www.uniprot.org/uniprot/Q9SMJ5 Q9SMJ5]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=dTDP-glucose 4,6-dehydratase}}
+
−
{{#set: ec number=EC-4.2.1.46}}
+
−
{{#set: gene associated=Ec-01_007350|Ec-27_005770}}
+
−
{{#set: in pathway=PWY-7315|PWY-7316|PWY-6953|PWY-7301|PWY-7657|PWY-7318|PWY-7312|PWY-6942|PWY-7104|PWY-7440|DTDPRHAMSYN-PWY|PWY-6808|PWY-7413|PWY-6976|PWY-7688|PWY-6974|PWY-6973|PWY-3221|PWY-7414}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:20, 21 March 2018

Metabolite ALLYSINE

  • smiles:
    • [CH](=O)CCCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
  • common name:
    • (S)-2-amino-6-oxohexanoate
  • molecular weight:
    • 145.158
  • Synonym(s):
    • allysine
    • L-2-aminoadipate 6-semialdehyde
    • 2-aminoadipate 6-semialdehyde
    • α-aminoadipate 6-semialdehyde
    • 2-aminoadipate semialdehyde
    • L-allysine
    • (S)-2-aminoadipate 6-semialdehyde
    • 2-aminoadipate-6-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 1962-83-0
  • PUBCHEM:
  • HMDB : HMDB59595
  • LIGAND-CPD:
  • CHEBI:
  • METABOLIGHTS : MTBLC58321
"CH](=O)CCCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ALLYSINE&oldid=26209"