Difference between revisions of "P23-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] == * smiles: ** C1(=CC(NC(=O)N1)=O) * inchi key: ** InChIKey=ISAKRJDGNUQOIC-UHFF...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC(NC(=O)N1)=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
−
** InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783]
 
* common name:
 
* common name:
−
** uracil
+
** reductive TCA cycle I
−
* molecular weight:
+
−
** 112.088   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** reductive tricarboxylic acid cycle
 +
** reductive tricarboxylic acid pathway
 +
** reductive citric acid cycle
 +
** reverse citric acid cycle
 +
** carbon fixation
 +
** CO2 fixation
 +
** reductive carboxylic acid cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[URACIL-PRIBOSYLTRANS-RXN]]
+
'''10''' reactions found over '''12''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
−
* [[RXN0-5398]]
+
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_008380]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-25_001360]]
 +
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PEPSYNTH-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-18_003420]]
 +
*** [[Ec-15_004230]]
 +
*** [[Ec-23_002710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_000030]]
 +
*** [[Ec-02_001020]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 66-22-8
+
{{#set: taxonomic range=TAX-3052}}
−
* BIGG : 33879
+
{{#set: taxonomic range=TAX-1224}}
−
* DRUGBANK : DB03419
+
{{#set: taxonomic range=TAX-2157}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-68336}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1174 1174]
+
{{#set: taxonomic range=TAX-200783}}
−
* HMDB : HMDB00300
+
{{#set: common name=reductive TCA cycle I}}
−
* LIGAND-CPD:
+
{{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00106 C00106]
+
{{#set: reaction found=10}}
−
* CHEMSPIDER:
+
{{#set: total reaction=12}}
−
** [http://www.chemspider.com/Chemical-Structure.1141.html 1141]
+
{{#set: completion rate=83.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17568 17568]
+
−
* METABOLIGHTS : MTBLC17568
+
−
{{#set: smiles=C1(=CC(NC(=O)N1)=O)}}
+
−
{{#set: inchi key=InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N}}
+
−
{{#set: common name=uracil}}
+
−
{{#set: molecular weight=112.088    }}
+
−
{{#set: consumed by=URACIL-PRIBOSYLTRANS-RXN}}
+
−
{{#set: reversible reaction associated=RXN0-5398}}
+

Latest revision as of 19:20, 21 March 2018

Pathway P23-PWY

  • taxonomic range:
  • common name:
    • reductive TCA cycle I
  • Synonym(s):
    • reductive tricarboxylic acid cycle
    • reductive tricarboxylic acid pathway
    • reductive citric acid cycle
    • reverse citric acid cycle
    • carbon fixation
    • CO2 fixation
    • reductive carboxylic acid cycle

Reaction(s) found

10 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=P23-PWY&oldid=26246"