Difference between revisions of "Ec-24 003110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-24_003110 == * left end position: ** 3383362 * transcription direction: ** NEGATIVE * right end position: ** 3388656 * centisome position: ** 67.8...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_003110 == |
− | * | + | * left end position: |
− | ** | + | ** 3383362 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3388656 |
− | * | + | * centisome position: |
− | ** | + | ** 67.83449 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0034_0160 |
− | ** | + | ** Esi0034_0160 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[HYDROG-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-6780]] |
+ | * [[PWY4LZ-257]] | ||
+ | * [[PWY-6785]] | ||
+ | * [[PWY-6759]] | ||
+ | * [[GLUDEG-II-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3383362}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3388656}} | |
− | + | {{#set: centisome position=67.83449 }} | |
− | + | {{#set: common name=Esi_0034_0160|Esi0034_0160}} | |
− | {{#set: | + | {{#set: reaction associated=HYDROG-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6780|PWY4LZ-257|PWY-6785|PWY-6759|GLUDEG-II-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:20, 21 March 2018
Gene Ec-24_003110
- left end position:
- 3383362
- transcription direction:
- NEGATIVE
- right end position:
- 3388656
- centisome position:
- 67.83449
- Synonym(s):
- Esi_0034_0160
- Esi0034_0160
Reactions associated
- Reaction: HYDROG-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome