Difference between revisions of "PWY-5663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] | ||
* common name: | * common name: | ||
| − | ** | + | ** tetrahydrobiopterin biosynthesis I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[4.2.3.12-RXN]] |
| − | + | ** 2 associated gene(s): | |
| − | * [[ | + | *** [[Ec-10_002190]] |
| + | *** [[Ec-27_003470]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[GTP-CYCLOHYDRO-I-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-27_007000]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-8853]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33682}} | |
| − | + | {{#set: taxonomic range=TAX-68336}} | |
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: common name=tetrahydrobiopterin biosynthesis I}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:20, 21 March 2018
Pathway PWY-5663
- taxonomic range:
- common name:
- tetrahydrobiopterin biosynthesis I
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 4.2.3.12-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8853
- 0 associated gene:
- 1 reconstruction source(s) associated:
