Difference between revisions of "PWY-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J
+
 
* common name:
 
* common name:
** UTP
+
** L-carnitine degradation III
* molecular weight:
+
** 480.112   
+
 
* Synonym(s):
 
* Synonym(s):
** uridine-triphosphate
 
** uridine-5'-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-724]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[CTPSYN-RXN]]
+
* [[1.1.1.39-RXN]]
* [[RXN-14139]]
+
** 3 associated gene(s):
* [[NAG1P-URIDYLTRANS-RXN]]
+
*** [[Ec-01_003680]]
* [[RXN-12199]]
+
*** [[Ec-07_002070]]
* [[RXN-14325]]
+
*** [[Ec-07_002060]]
== Reaction(s) known to produce the compound ==
+
** 1 reconstruction source(s) associated:
* [[UDPKIN-RXN]]
+
*** [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-6002]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
** 1 associated gene(s):
* [[RXN-12196]]
+
*** [[Ec-11_002450]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5921 RXN-5921]
 
== External links  ==
 
== External links  ==
* CAS : 63-39-8
+
{{#set: taxonomic range=TAX-1224}}
* BIGG : 33760
+
{{#set: common name=L-carnitine degradation III}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058168 7058168]
+
{{#set: total reaction=3}}
* HMDB : HMDB00285
+
{{#set: completion rate=67.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00075 C00075]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5414500.html 5414500]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46398 46398]
+
* METABOLIGHTS : MTBLC46398
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}}
+
{{#set: inchi key=InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J}}
+
{{#set: common name=UTP}}
+
{{#set: molecular weight=480.112    }}
+
{{#set: common name=uridine-triphosphate|uridine-5'-triphosphate}}
+
{{#set: consumed by=RXN0-724|CTPSYN-RXN|RXN-14139|NAG1P-URIDYLTRANS-RXN|RXN-12199|RXN-14325}}
+
{{#set: produced by=UDPKIN-RXN}}
+
{{#set: reversible reaction associated=GLUC1PURIDYLTRANS-RXN|RXN-12196}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-3641

  • taxonomic range:
  • common name:
    • L-carnitine degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links