Difference between revisions of "PWY-6471"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLD...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] ==
* smiles:
+
* taxonomic range:
** CC(O)C([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-186826]
* inchi key:
+
** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
+
 
* common name:
 
* common name:
** L-threonine
+
** peptidoglycan biosynthesis IV (Enterococcus faecium)
* molecular weight:
+
** 119.12   
+
 
* Synonym(s):
 
* Synonym(s):
** T
 
** thr
 
** thre
 
** L-thr
 
** threonine
 
** 2-amino-3-hydroxybutyric acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[biomass_rxn]]
+
'''2''' reactions found over '''10''' reactions in the full pathway
* [[THREONINE--TRNA-LIGASE-RXN]]
+
* [[PWY-6386]]
* [[THREDEHYD-RXN]]
+
** 0 associated gene:
* [[THREONINE-ALDOLASE-RXN]]
+
* [[RXN-8975]]
* [[RXN-15122]]
+
** 1 associated gene(s):
== Reaction(s) known to produce the compound ==
+
*** [[Ec-07_007020]]
* [[THRESYN-RXN]]
+
** 1 reconstruction source(s) associated:
== Reaction(s) of unknown directionality ==
+
*** [[annotation-esiliculosus_genome]]
* [[RXN-14569]]
+
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11339 RXN-11339]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11350 RXN-11350]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11351 RXN-11351]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8976 RXN-8976]
 
== External links  ==
 
== External links  ==
* CAS : 72-19-5
+
{{#set: taxonomic range=TAX-186826}}
* BIGG : 34186
+
{{#set: common name=peptidoglycan biosynthesis IV (Enterococcus faecium)}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019]
+
{{#set: total reaction=10}}
* HMDB : HMDB00167
+
{{#set: completion rate=20.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926]
+
* METABOLIGHTS : MTBLC57926
+
{{#set: smiles=CC(O)C([N+])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}}
+
{{#set: common name=L-threonine}}
+
{{#set: molecular weight=119.12    }}
+
{{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}}
+
{{#set: consumed by=biomass_rxn|THREONINE--TRNA-LIGASE-RXN|THREDEHYD-RXN|THREONINE-ALDOLASE-RXN|RXN-15122}}
+
{{#set: produced by=THRESYN-RXN}}
+
{{#set: consumed or produced by=RXN-14569}}
+

Latest revision as of 20:21, 21 March 2018

Pathway PWY-6471

  • taxonomic range:
  • common name:
    • peptidoglycan biosynthesis IV (Enterococcus faecium)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links