Difference between revisions of "2.7.1.133-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** inositol-1,3,4-tris...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** inositol-1,3,4-trisphosphate 5-kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.159 EC-2.7.1.159] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-505]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''=>''' 1 H+[c] '''+''' 1 D-myo-inositol (1,3,4,6)-tetrakisphosphate[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-05_003010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-6366]], D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20940 20940] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03429 R03429] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | {{#set: | + | {{#set: common name=inositol-1,3,4-trisphosphate 5-kinase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.159}} |
− | {{#set: | + | {{#set: gene associated=Ec-05_003010}} |
− | {{#set: | + | {{#set: in pathway=PWY-6366|PWY-6365|PWY-6362|PWY-6554}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 19:21, 21 March 2018
Contents
Reaction 2.7.1.133-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- inositol-1,3,4-trisphosphate 5-kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 INOSITOL-1-3-4-TRIPHOSPHATE[c] => 1 PROTON[c] + 1 CPD-505[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 D-myo-inositol (1,3,4)-trisphosphate[c] => 1 H+[c] + 1 D-myo-inositol (1,3,4,6)-tetrakisphosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-05_003010
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6366, D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: PWY-6366
- 2 reactions found over 4 reactions in the full pathway
- PWY-6365, D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: PWY-6365
- 4 reactions found over 4 reactions in the full pathway
- PWY-6362, 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): PWY-6362
- 4 reactions found over 5 reactions in the full pathway
- PWY-6554, 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): PWY-6554
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links