Difference between revisions of "THR"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_000200 == * left end position: ** 253977 * transcription direction: ** NEGATIVE * right end position: ** 260590 * centisome position: ** 3.8901...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLD...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(O)C([N+])C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N |
| − | * | + | * common name: |
| − | ** | + | ** L-threonine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 119.12 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** T |
| − | ** | + | ** thr |
| − | ** | + | ** thre |
| + | ** L-thr | ||
| + | ** threonine | ||
| + | ** 2-amino-3-hydroxybutyric acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[biomass_rxn]] |
| − | ** | + | * [[THREONINE--TRNA-LIGASE-RXN]] |
| − | ** | + | * [[THREDEHYD-RXN]] |
| − | == | + | * [[THREONINE-ALDOLASE-RXN]] |
| + | * [[RXN-15122]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[THRESYN-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14569]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 72-19-5 |
| − | {{#set: | + | * BIGG : 34186 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019] |
| − | {{#set: common name= | + | * HMDB : HMDB00167 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926] | ||
| + | * METABOLIGHTS : MTBLC57926 | ||
| + | {{#set: smiles=CC(O)C([N+])C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}} | ||
| + | {{#set: common name=L-threonine}} | ||
| + | {{#set: molecular weight=119.12 }} | ||
| + | {{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}} | ||
| + | {{#set: consumed by=biomass_rxn|THREONINE--TRNA-LIGASE-RXN|THREDEHYD-RXN|THREONINE-ALDOLASE-RXN|RXN-15122}} | ||
| + | {{#set: produced by=THRESYN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14569}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite THR
- smiles:
- CC(O)C([N+])C(=O)[O-]
- inchi key:
- InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
- common name:
- L-threonine
- molecular weight:
- 119.12
- Synonym(s):
- T
- thr
- thre
- L-thr
- threonine
- 2-amino-3-hydroxybutyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-19-5
- BIGG : 34186
- PUBCHEM:
- HMDB : HMDB00167
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57926
"CC(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
