Difference between revisions of "PWY-5989"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** stearate biosynthesis II (bacteria and plants) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** stearic acid biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''6''' reactions found over '''6''' reactions in the full pathway |
− | + | * [[RXN-16380]] | |
− | == Reaction(s) | + | ** 4 associated gene(s): |
+ | *** [[Ec-01_001560]] | ||
+ | *** [[Ec-02_006430]] | ||
+ | *** [[Ec-12_008720]] | ||
+ | *** [[Ec-03_003710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9548]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9632]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9633]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9634]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9635]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002470]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=stearate biosynthesis II (bacteria and plants)}} | |
− | + | {{#set: common name=stearic acid biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:21, 21 March 2018
Pathway PWY-5989
- taxonomic range:
- common name:
- stearate biosynthesis II (bacteria and plants)
- Synonym(s):
- stearic acid biosynthesis
Reaction(s) found
6 reactions found over 6 reactions in the full pathway
- RXN-16380
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9548
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9632
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9633
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9634
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9635
- 1 associated gene(s):
- 2 reconstruction source(s) associated: