Difference between revisions of "RXN-15346"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15346 RXN-15346] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15346 RXN-15346] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPD-16551]][c] '''=>''' 1 [[CPD-15895]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 β-D-ribose 5-phosphate[c] '''=>''' 1 keto-D-ribose 5-phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Contents
Reaction RXN-15346
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 β-D-ribose 5-phosphate[c] => 1 keto-D-ribose 5-phosphate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
