Difference between revisions of "PWY-3161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3161 PWY-3161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3161 PWY-3161] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** indole-3-acetate biosynthesis III (bacteria) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** IAA biosynthesis III (bacteria) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[RXNN-404]] |
| − | * | + | ** 2 associated gene(s): |
| − | + | *** [[Ec-02_005910]] | |
| − | * [[ | + | *** [[Ec-06_009020]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-esiliculosus_genome]] |
| − | == Reaction(s) | + | == Reaction(s) not found == |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=TRYPTOPHAN-2-MONOOXYGENASE-RXN TRYPTOPHAN-2-MONOOXYGENASE-RXN] |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=indole-3-acetate biosynthesis III (bacteria)}} | |
| − | + | {{#set: common name=IAA biosynthesis III (bacteria)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:21, 21 March 2018
Pathway PWY-3161
- taxonomic range:
- common name:
- indole-3-acetate biosynthesis III (bacteria)
- Synonym(s):
- IAA biosynthesis III (bacteria)
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXNN-404
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
