Difference between revisions of "CPD-13118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-tetracos-2-enoyl-[acy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
 +
* inchi key:
 +
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
 
* common name:
 
* common name:
−
** trans-tetracos-2-enoyl-[acyl-carrier protein] reductase
+
** GDP-β-L-fucose
−
** Glucose/ribitol dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 587.33   
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[trans-delta2-lignoceroyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Lignoceroyl-ACPs]][c]
+
* [[1.1.1.271-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 a trans-tetracos-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a lignoceroyl-[acp][c]
+
* [[2.4.1.221-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_002470]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''30''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-tetracos-2-enoyl-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
−
{{#set: common name=Glucose/ribitol dehydrogenase}}
+
* CHEBI:
−
{{#set: ec number=EC-1.3.1.9}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
−
{{#set: gene associated=Ec-27_002470}}
+
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
−
{{#set: in pathway=PWYG-321}}
+
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=GDP-β-L-fucose}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=587.33    }}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=1.1.1.271-RXN}}
 +
{{#set: reversible reaction associated=2.4.1.221-RXN}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-13118

  • smiles:
    • CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
  • inchi key:
    • InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
  • common name:
    • GDP-β-L-fucose
  • molecular weight:
    • 587.33
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-13118&oldid=26393"