Difference between revisions of "CPD-13118"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-tetracos-2-enoyl-[acy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == |
− | * | + | * smiles: |
− | ** | + | ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O) |
+ | * inchi key: | ||
+ | ** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** GDP-β-L-fucose |
− | * | + | * molecular weight: |
− | + | ** 587.33 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.1.1.271-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | * [[2.4.1.221-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273] |
− | {{#set: | + | {{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}} |
− | {{#set: | + | {{#set: common name=GDP-β-L-fucose}} |
− | {{#set: | + | {{#set: molecular weight=587.33 }} |
− | {{#set: | + | {{#set: produced by=1.1.1.271-RXN}} |
+ | {{#set: reversible reaction associated=2.4.1.221-RXN}} |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-13118
- smiles:
- CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
- inchi key:
- InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
- common name:
- GDP-β-L-fucose
- molecular weight:
- 587.33
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.